CAS 878419-78-4 appears in our catalog under these names: Walrycin B/ 99.16% (existing batch purity), Walrycin B, Walrycin B 98%, 1,6-Dimethyl-3-[4-(trifluoromethyl)phenyl]pyrimido[5,4-e]-1,2,4-triazine-5,7(1H,6H)-dione, 98%, 98%, Walrycin B, 98.11%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
1,6-dimethyl-3-[4-(trifluoromethyl)phenyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione (CAS 878419-78-4) is a chemical compound with the molecular formula C14H10F3N5O2 and a molecular weight of 337.26 g/mol. IUPAC name: 1,6-dimethyl-3-[4-(trifluoromethyl)phenyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione. InChIKey: XRVMPTWWKLKLPB-UHFFFAOYSA-N.
| Molecular formula | C14H10F3N5O2 |
|---|---|
| Molecular weight | 337.26 g/mol |
| IUPAC name | 1,6-dimethyl-3-[4-(trifluoromethyl)phenyl]pyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| InChIKey | XRVMPTWWKLKLPB-UHFFFAOYSA-N |
| SMILES | CN1C2=NC(=O)N(C(=O)C2=NC(=N1)C3=CC=C(C=C3)C(F)(F)F)C |
Computed by PubChem (NCBI)