cas: 524-12-9 — see every product listed under this CAS number, including other names
Wedelolactone 98% (CAS 524-12-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A523974-1mg |
| cas | 524-12-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 153.44 Pln | |
| Ambeed | 5mg | 225.75 Pln | |
| Ambeed | 10mg | 298.06 Pln | |
| Ambeed | 50mg | 592.88 Pln | |
| Ambeed | 100mg | 726.38 Pln | |
| Ambeed | 250mg | 1538.50 Pln | |
| Ambeed | 1g | 4809.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A523974 |
1,8,9-trihydroxy-3-methoxy-[1]benzofuro[3,2-c]chromen-6-one (CAS 524-12-9) is a chemical compound with the molecular formula C16H10O7 and a molecular weight of 314.25 g/mol. IUPAC name: 1,8,9-trihydroxy-3-methoxy-[1]benzofuro[3,2-c]chromen-6-one. InChIKey: XQDCKJKKMFWXGB-UHFFFAOYSA-N.
| Molecular formula | C16H10O7 |
|---|---|
| Molecular weight | 314.25 g/mol |
| IUPAC name | 1,8,9-trihydroxy-3-methoxy-[1]benzofuro[3,2-c]chromen-6-one |
| InChIKey | XQDCKJKKMFWXGB-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)OC(=O)C3=C2OC4=CC(=C(C=C43)O)O)O |
Computed by PubChem (NCBI)