CAS 135989-69-4 appears in our catalog under these names: Benzophenone-2,4,5-tricarboxylic acid, 95%, Benzophenone-2,4,5-tricarboxylic Acid, >98.0%(T), Benzophenone-2,4,5-tricarboxylic Acid, 98%, 98%, 2,4,5-Tricarboxybenzophenone, 98%. Offered by: Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5-benzoylbenzene-1,2,4-tricarboxylic acid (CAS 135989-69-4) is a chemical compound with the molecular formula C16H10O7 and a molecular weight of 314.25 g/mol. IUPAC name: 5-benzoylbenzene-1,2,4-tricarboxylic acid. InChIKey: OGQPSIOWWYARAZ-UHFFFAOYSA-N.
| Molecular formula | C16H10O7 |
|---|---|
| Molecular weight | 314.25 g/mol |
| IUPAC name | 5-benzoylbenzene-1,2,4-tricarboxylic acid |
| InChIKey | OGQPSIOWWYARAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)