Products 113418-56-7
CAS 113418-56-7 appears in our catalog under these names: Wy 49051/ 97.9% (existing batch purity), Wy 49051, 7-(3-(4-(Diphenylmethoxy)-1-piperidinyl)propyl)-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, Wy 49051, Wy 49051, 98.70%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 20mg.
7-[3-(4-benzhydryloxypiperidin-1-yl)propyl]-1,3-dimethylpurine-2,6-dione (CAS 113418-56-7) is a chemical compound with the molecular formula C28H33N5O3 and a molecular weight of 487.6 g/mol. IUPAC name: 7-[3-(4-benzhydryloxypiperidin-1-yl)propyl]-1,3-dimethylpurine-2,6-dione. InChIKey: YNDYDETWRDHMLW-UHFFFAOYSA-N.
| Molecular formula | C28H33N5O3 |
|---|---|
| Molecular weight | 487.6 g/mol |
| IUPAC name | 7-[3-(4-benzhydryloxypiperidin-1-yl)propyl]-1,3-dimethylpurine-2,6-dione |
| InChIKey | YNDYDETWRDHMLW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCCN3CCC(CC3)OC(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)