cas: 945755-56-6 — see every product listed under this CAS number, including other names
XL019 98% (CAS 945755-56-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A403201-1mg |
| cas | 945755-56-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 186.81 Pln | |
| Ambeed | 2mg | 214.62 Pln | |
| Ambeed | 5mg | 264.69 Pln | |
| Ambeed | 10mg | 337.00 Pln | |
| Ambeed | 25mg | 520.56 Pln | |
| Ambeed | 50mg | 698.56 Pln | |
| Ambeed | 100mg | 1065.69 Pln | |
| Ambeed | 250mg | 1777.69 Pln | |
| Ambeed | 1g | 4514.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A403201 |
(2S)-N-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide (CAS 945755-56-6) is a chemical compound with the molecular formula C25H28N6O2 and a molecular weight of 444.5 g/mol. IUPAC name: (2S)-N-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide. InChIKey: ISOCDPQFIXDIMS-QHCPKHFHSA-N.
| Molecular formula | C25H28N6O2 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | (2S)-N-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
| InChIKey | ISOCDPQFIXDIMS-QHCPKHFHSA-N |
| SMILES | C1C[C@H](NC1)C(=O)NC2=CC=C(C=C2)C3=NC(=NC=C3)NC4=CC=C(C=C4)N5CCOCC5 |
Computed by PubChem (NCBI)