cas: 945755-56-6 — see every product listed under this CAS number, including other names
XL019, 98%, 98% (CAS 945755-56-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DMY1-1mg |
| cas | 945755-56-6 |
| size | 1mg |
| availability | 0.75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 112.40 Pln | |
| Chemat | 2mg | 122.00 Pln | |
| Chemat | 5mg | 131.60 Pln | |
| Chemat | 25mg | 304.40 Pln | |
| Chemat | 50mg | 472.40 Pln | |
| Chemat | 100mg | 717.20 Pln | |
| Chemat | 250mg | 1173.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-N-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide (CAS 945755-56-6) is a chemical compound with the molecular formula C25H28N6O2 and a molecular weight of 444.5 g/mol. IUPAC name: (2S)-N-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide. InChIKey: ISOCDPQFIXDIMS-QHCPKHFHSA-N.
| Molecular formula | C25H28N6O2 |
|---|---|
| Molecular weight | 444.5 g/mol |
| IUPAC name | (2S)-N-[4-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]phenyl]pyrrolidine-2-carboxamide |
| InChIKey | ISOCDPQFIXDIMS-QHCPKHFHSA-N |
| SMILES | C1C[C@H](NC1)C(=O)NC2=CC=C(C=C2)C3=NC(=NC=C3)NC4=CC=C(C=C4)N5CCOCC5 |
Computed by PubChem (NCBI)