CAS 5968-90-1 appears in our catalog under these names: Xanthosine Dihydrate, >95% (HPLC), Xanthosine dihydrate/ 99.9%, Xanthosine dihydrate, Xanthosine dihydrate, Xanthosine dihydrate, 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Thermo Scientific (Acros). Available pack sizes: 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5g.
9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione;dihydrate (CAS 5968-90-1) is a chemical compound with the molecular formula C10H16N4O8 and a molecular weight of 320.26 g/mol. IUPAC name: 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione;dihydrate. InChIKey: ZCCPXSQIUORWCO-LGVAUZIVSA-N.
| Molecular formula | C10H16N4O8 |
|---|---|
| Molecular weight | 320.26 g/mol |
| IUPAC name | 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-2,6-dione;dihydrate |
| InChIKey | ZCCPXSQIUORWCO-LGVAUZIVSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)NC(=O)NC2=O.O.O |
Computed by PubChem (NCBI)