cas: 748778-73-6 — see every product listed under this CAS number, including other names
YC–001 (CAS 748778-73-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC64384-10 |
| cas | 748778-73-6 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 905.95 Pln | |
| GLPBio | 25mg | 1397.41 Pln | |
| GLPBio | 5mg | 709.37 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 737.45 Pln | |
| GLPBio | 50mg | 1987.15 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one (CAS 748778-73-6) is a chemical compound with the molecular formula C12H7ClO2S2 and a molecular weight of 282.8 g/mol. IUPAC name: 3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one. InChIKey: RCLLWMPOHNZNAO-UHFFFAOYSA-N.
| Molecular formula | C12H7ClO2S2 |
|---|---|
| Molecular weight | 282.8 g/mol |
| IUPAC name | 3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one |
| InChIKey | RCLLWMPOHNZNAO-UHFFFAOYSA-N |
| SMILES | C1C(=C(C(=O)O1)C2=CC=CS2)C3=CC=C(S3)Cl |
Computed by PubChem (NCBI)