CAS 748778-73-6 appears in our catalog under these names: 4-(5-Chlorothiophen-2-yl)-3-(thiophen-2-yl)-2,5-dihydrofuran-2-one, 95%, 4-(5-Chlorothiophen-2-yl)-3-(thiophen-2-yl)-2,5-dihydrofuran-2-one, YC-001, 95%, YC-001, YC–001. Offered by: Combi-blocks, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: 1g, 100mg, 250mg, 750mg, 5g, 2mg, 10mg, 25mg.
3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one (CAS 748778-73-6) is a chemical compound with the molecular formula C12H7ClO2S2 and a molecular weight of 282.8 g/mol. IUPAC name: 3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one. InChIKey: RCLLWMPOHNZNAO-UHFFFAOYSA-N.
| Molecular formula | C12H7ClO2S2 |
|---|---|
| Molecular weight | 282.8 g/mol |
| IUPAC name | 3-(5-chlorothiophen-2-yl)-4-thiophen-2-yl-2H-furan-5-one |
| InChIKey | RCLLWMPOHNZNAO-UHFFFAOYSA-N |
| SMILES | C1C(=C(C(=O)O1)C2=CC=CS2)C3=CC=C(S3)Cl |
Computed by PubChem (NCBI)