CAS 383124-82-1 appears in our catalog under these names: YE 120/ 99.67% (existing batch purity), YE 120, YE-120, YE 120, ≥98%(HPLC), ≥98%(HPLC), YE120, 99.80%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 50mg, 25mg, 100mg, 5 mg, 10 mg.
2-[3-cyano-5-(3,4-dichlorophenyl)-4,5-dimethylfuran-2-ylidene]propanedinitrile (CAS 383124-82-1) is a chemical compound with the molecular formula C16H9Cl2N3O and a molecular weight of 330.2 g/mol. IUPAC name: 2-[3-cyano-5-(3,4-dichlorophenyl)-4,5-dimethylfuran-2-ylidene]propanedinitrile. InChIKey: RSWZFAPYKOARNG-UHFFFAOYSA-N.
| Molecular formula | C16H9Cl2N3O |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 2-[3-cyano-5-(3,4-dichlorophenyl)-4,5-dimethylfuran-2-ylidene]propanedinitrile |
| InChIKey | RSWZFAPYKOARNG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C#N)C#N)OC1(C)C2=CC(=C(C=C2)Cl)Cl)C#N |
Computed by PubChem (NCBI)