CAS 1364488-67-4 appears in our catalog under these names: YH239-EE/ 99.61% (existing batch purity), YH239–EE, YH239-EE, YH239-EE, 98.28%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 10 mg, 5 mg.
Ethyl 3-[2-(tert-butylamino)-1-[(4-chlorophenyl)methyl-formylamino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate (CAS 1364488-67-4) is a chemical compound with the molecular formula C25H27Cl2N3O4 and a molecular weight of 504.4 g/mol. IUPAC name: ethyl 3-[2-(tert-butylamino)-1-[(4-chlorophenyl)methyl-formylamino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate. InChIKey: OTUBDDRFPQLPKD-UHFFFAOYSA-N.
| Molecular formula | C25H27Cl2N3O4 |
|---|---|
| Molecular weight | 504.4 g/mol |
| IUPAC name | ethyl 3-[2-(tert-butylamino)-1-[(4-chlorophenyl)methyl-formylamino]-2-oxoethyl]-6-chloro-1H-indole-2-carboxylate |
| InChIKey | OTUBDDRFPQLPKD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)C=C(C=C2)Cl)C(C(=O)NC(C)(C)C)N(CC3=CC=C(C=C3)Cl)C=O |
Computed by PubChem (NCBI)