CAS 1346753-00-1 appears in our catalog under these names: YHO-13351/ 97.98% (existing batch purity), YHO–13351, YHO-13351, YHO-13351, 99.16%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 100mg, 50mg, 5 mg, 10 mg.
[1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-(diethylamino)acetate;methanesulfonic acid (CAS 1346753-00-1) is a chemical compound with the molecular formula C27H37N3O7S2 and a molecular weight of 579.7 g/mol. IUPAC name: [1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-(diethylamino)acetate;methanesulfonic acid. InChIKey: XOEIHKAPFXUACW-QMGGKDRNSA-N.
| Molecular formula | C27H37N3O7S2 |
|---|---|
| Molecular weight | 579.7 g/mol |
| IUPAC name | [1-[5-[(Z)-2-cyano-2-(3,4-dimethoxyphenyl)ethenyl]thiophen-2-yl]piperidin-4-yl] 2-(diethylamino)acetate;methanesulfonic acid |
| InChIKey | XOEIHKAPFXUACW-QMGGKDRNSA-N |
| SMILES | CCN(CC)CC(=O)OC1CCN(CC1)C2=CC=C(S2)/C=C(\C#N)/C3=CC(=C(C=C3)OC)OC.CS(=O)(=O)O |
Computed by PubChem (NCBI)