Products 875258-85-8
CAS 875258-85-8 appears in our catalog under these names: YIL 781, YIL 781/ 99.3% (existing batch purity), YIL 781, YIL-781 hydrochloride, YIL781 97%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 5 mg.
6-(4-fluorophenoxy)-2-methyl-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]quinazolin-4-one (CAS 875258-85-8) is a chemical compound with the molecular formula C24H28FN3O2 and a molecular weight of 409.5 g/mol. IUPAC name: 6-(4-fluorophenoxy)-2-methyl-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]quinazolin-4-one. InChIKey: FRKXOBMDEXCHHD-SFHVURJKSA-N.
| Molecular formula | C24H28FN3O2 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | 6-(4-fluorophenoxy)-2-methyl-3-[[(3S)-1-propan-2-ylpiperidin-3-yl]methyl]quinazolin-4-one |
| InChIKey | FRKXOBMDEXCHHD-SFHVURJKSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)OC3=CC=C(C=C3)F)C(=O)N1C[C@H]4CCCN(C4)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
yil-781, orb1703908