CAS 1215281-19-8 appears in our catalog under these names: YK-3-237/ 96.38% (existing batch purity), YK–3–237, YK 3-237, (E)-(2-Methoxy-5-(3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-en-1-yl)phenyl)boronic acid, 97%, 97%, YK-3-237, 99.54%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
[2-methoxy-5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]boronic acid (CAS 1215281-19-8) is a chemical compound with the molecular formula C19H21BO7 and a molecular weight of 372.2 g/mol. IUPAC name: [2-methoxy-5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]boronic acid. InChIKey: AKNGHUAJAODDJA-FNORWQNLSA-N.
| Molecular formula | C19H21BO7 |
|---|---|
| Molecular weight | 372.2 g/mol |
| IUPAC name | [2-methoxy-5-[(E)-3-oxo-3-(3,4,5-trimethoxyphenyl)prop-1-enyl]phenyl]boronic acid |
| InChIKey | AKNGHUAJAODDJA-FNORWQNLSA-N |
| SMILES | B(C1=C(C=CC(=C1)/C=C/C(=O)C2=CC(=C(C(=C2)OC)OC)OC)OC)(O)O |
Computed by PubChem (NCBI)