Products 90596-75-1
CAS 90596-75-1 appears in our catalog under these names: YT 146/ 99.72% (existing batch purity), YT 146, YT 146, 99.72%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
(2R,3R,4S,5R)-2-(6-amino-2-oct-1-ynylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 90596-75-1) is a chemical compound with the molecular formula C18H25N5O4 and a molecular weight of 375.4 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-amino-2-oct-1-ynylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: NVGGIHKSKVAPEY-XKLVTHTNSA-N.
| Molecular formula | C18H25N5O4 |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-amino-2-oct-1-ynylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | NVGGIHKSKVAPEY-XKLVTHTNSA-N |
| SMILES | CCCCCCC#CC1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)