CAS 2225824-53-1 appears in our catalog under these names: YTX-465/ 99.41% (existing batch purity), YTX–465, YTX-465, YTX-465, 99.06%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 50 mg.
N-[2-[4-[3-(1,3-dimethylindazol-6-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]benzamide (CAS 2225824-53-1) is a chemical compound with the molecular formula C25H26N6O3 and a molecular weight of 458.5 g/mol. IUPAC name: N-[2-[4-[3-(1,3-dimethylindazol-6-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]benzamide. InChIKey: UNYSKYOVUXWBJG-UHFFFAOYSA-N.
| Molecular formula | C25H26N6O3 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | N-[2-[4-[3-(1,3-dimethylindazol-6-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]-2-oxoethyl]benzamide |
| InChIKey | UNYSKYOVUXWBJG-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=CC(=C2)C3=NOC(=N3)C4CCN(CC4)C(=O)CNC(=O)C5=CC=CC=C5)C |
Computed by PubChem (NCBI)