CAS 1943733-16-1 appears in our catalog under these names: YU238259/ 99.43% (existing batch purity), YU238259, YU238259 98%, YU238259, 98%, 98%, YU238259, 98.56%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
N-[2-(5-chloro-2-pyridinyl)ethyl]-4-[[(4-methoxyphenyl)sulfonylamino]methyl]benzamide (CAS 1943733-16-1) is a chemical compound with the molecular formula C22H22ClN3O4S and a molecular weight of 459.9 g/mol. IUPAC name: N-[2-(5-chloro-2-pyridinyl)ethyl]-4-[[(4-methoxyphenyl)sulfonylamino]methyl]benzamide. InChIKey: BIHURSOREGLQBB-UHFFFAOYSA-N.
| Molecular formula | C22H22ClN3O4S |
|---|---|
| Molecular weight | 459.9 g/mol |
| IUPAC name | N-[2-(5-chloro-2-pyridinyl)ethyl]-4-[[(4-methoxyphenyl)sulfonylamino]methyl]benzamide |
| InChIKey | BIHURSOREGLQBB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NCC2=CC=C(C=C2)C(=O)NCCC3=NC=C(C=C3)Cl |
Computed by PubChem (NCBI)