cas: 6382-93-0 — see every product listed under this CAS number, including other names
Z-D-Arg-OH 98% (CAS 6382-93-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A694295-1g |
| cas | 6382-93-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 665.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A694295 |
(2R)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 6382-93-0) is a chemical compound with the molecular formula C14H20N4O4 and a molecular weight of 308.33 g/mol. IUPAC name: (2R)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: SJSSFUMSAFMFNM-LLVKDONJSA-N.
| Molecular formula | C14H20N4O4 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | (2R)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | SJSSFUMSAFMFNM-LLVKDONJSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)