CAS 1234-35-1 appears in our catalog under these names: Z-L-Arginine, Z–Arg–OH, Z-L-Arg-OH, Nalpha-Carbobenzoxy-L-arginine, >97.0%(T), Z-Arg-OH 97%. Offered by: TRC, GLPBio, Iris Biotech, TCI, Biosynth. Available pack sizes: 10g, 25g, 5g, 100g, 250g, 1g, 0,1kg, 0,05kg.
(2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 1234-35-1) is a chemical compound with the molecular formula C14H20N4O4 and a molecular weight of 308.33 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: SJSSFUMSAFMFNM-NSHDSACASA-N.
| Molecular formula | C14H20N4O4 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | SJSSFUMSAFMFNM-NSHDSACASA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)