CAS 1312201-00-5 appears in our catalog under these names: Z-HA155/ 98.28% (existing batch purity), HA155, HA155 98%, HA155, 98%, 98%, HA155, 98.00%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
[4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]phenyl]boronic acid (CAS 1312201-00-5) is a chemical compound with the molecular formula C24H19BFNO5S and a molecular weight of 463.3 g/mol. IUPAC name: [4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]phenyl]boronic acid. InChIKey: BRWUZCBSWABPMR-XKZIYDEJSA-N.
| Molecular formula | C24H19BFNO5S |
|---|---|
| Molecular weight | 463.3 g/mol |
| IUPAC name | [4-[[4-[(Z)-[3-[(4-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]phenyl]boronic acid |
| InChIKey | BRWUZCBSWABPMR-XKZIYDEJSA-N |
| SMILES | B(C1=CC=C(C=C1)COC2=CC=C(C=C2)/C=C\3/C(=O)N(C(=O)S3)CC4=CC=C(C=C4)F)(O)O |
Computed by PubChem (NCBI)