cas: 2212-69-3 — see every product listed under this CAS number, including other names
Z-Lys(Boc)-ONp, 95% (CAS 2212-69-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 10g, 25g, 500g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A486512-100g |
| cas | 2212-69-3 |
| size | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 1538.50 Pln | |
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 203.60 Pln | |
| Chemat | 10g | 299.60 Pln | |
| Chemat | 25g | 534.80 Pln | |
| Chemat | 100g | 1470.80 Pln | |
| Chemat | 500g | 5774.40 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 225.50 Pln | |
| BLDpharm | 10g | 331.02 Pln | |
| BLDpharm | 25g | 580.93 Pln | |
| BLDpharm | 100g | 1652.78 Pln | |
| BLDpharm | 500g | 6390.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4-nitrophenyl) (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate (CAS 2212-69-3) is a chemical compound with the molecular formula C25H31N3O8 and a molecular weight of 501.5 g/mol. IUPAC name: (4-nitrophenyl) (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate. InChIKey: XBMRVOHLFIZDDV-NRFANRHFSA-N.
| Molecular formula | C25H31N3O8 |
|---|---|
| Molecular weight | 501.5 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate |
| InChIKey | XBMRVOHLFIZDDV-NRFANRHFSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)