CAS 2212-69-3 appears in our catalog under these names: Z–Lys(Boc)–ONp, Z-Lys(Boc)-ONp 95%, Z-Lys(Boc)-ONp, 95%, 95%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g.
(4-nitrophenyl) (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate (CAS 2212-69-3) is a chemical compound with the molecular formula C25H31N3O8 and a molecular weight of 501.5 g/mol. IUPAC name: (4-nitrophenyl) (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate. InChIKey: XBMRVOHLFIZDDV-NRFANRHFSA-N.
| Molecular formula | C25H31N3O8 |
|---|---|
| Molecular weight | 501.5 g/mol |
| IUPAC name | (4-nitrophenyl) (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(phenylmethoxycarbonylamino)hexanoate |
| InChIKey | XBMRVOHLFIZDDV-NRFANRHFSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](C(=O)OC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)