cas: 24787-89-1 — see every product listed under this CAS number, including other names
Z-Val-Ala-OH, 99.78% (CAS 24787-89-1) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 5 g, 1 g, 100 g, 10 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-42709-50 g |
| cas | 24787-89-1 |
| size | 50 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 1513.20 Pln | |
| MedChemExpress | 5 g | 361.49 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 100 g | 2098.34 Pln | |
| MedChemExpress | 10 g | 505.45 Pln | |
| MedChemExpress | 25 g | 1007.00 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.78% |
(2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoic acid (CAS 24787-89-1) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoic acid. InChIKey: KDQLNJPBTLIYNW-AAEUAGOBSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | (2S)-2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoic acid |
| InChIKey | KDQLNJPBTLIYNW-AAEUAGOBSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)