CAS 13512-57-7 appears in our catalog under these names: Boc-Asn-OBzl, 96%, (S)–Benzyl 4–amino–2–((tert–butoxycarbonyl)amino)–4–oxobutanoate, Boc-Asn-OBzl 97%, (S)-Benzyl 4-Amino-2-((Tert-Butoxycarbonyl)Amino)-4-Oxobutanoate, 97%, 97%, (S)-Benzyl 4-amino-2-((tert-butoxycarbonyl)amino)-4-oxobutanoate, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100g, 10g, 25g, 100mg, 250mg, 50g.
Benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (CAS 13512-57-7) is a chemical compound with the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. IUPAC name: benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate. InChIKey: VNFPRPGXGYMAKL-LBPRGKRZSA-N.
| Molecular formula | C16H22N2O5 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | benzyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| InChIKey | VNFPRPGXGYMAKL-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)N)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)