Z-Val-Gly-OH, 98%, 98%
cas: 2790-84-3 — see every product listed under this CAS number, including other names
Z-Val-Gly-OH, 98%, 98% (CAS 2790-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BEVH-100g |
| cas | 2790-84-3 |
| size | 100g |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 1346.00 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 213.20 Pln | |
| Chemat | 25g | 438.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid (CAS 2790-84-3) is a chemical compound with the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. IUPAC name: 2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid. InChIKey: MWOJWUBBCZRMTB-ZDUSSCGKSA-N.
| Molecular formula | C15H20N2O5 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 2-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]acetic acid |
| InChIKey | MWOJWUBBCZRMTB-ZDUSSCGKSA-N |
| SMILES | CC(C)[C@@H](C(=O)NCC(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
Z-Val-Gly-OH, Cbz-Val-Gly-OH, ((Benzyloxy)carbonyl)-L-valylglycine, Z-L-valyl-L-glycine, (S)-2-(2-(((Benzyloxy)carbonyl)amino)-3-methylbutanamido)acetic acid, N-benzyloxycarbonylvalylglycine, 2-[(2S)-2-{[(benzyloxy)carbonyl]amino}-3-methylbutanamido]acetic acid, s12379, (S)-2-(2-(Cbz-amino)-3-methylbutanamido)acetic Acid, 2-[[(2S)-2-(benzyloxycarbonylamino)-3-methyl-butanoyl]amino]acetic acid