CAS 1952264-33-3 appears in our catalog under these names: ZEN-3862/ 97.1% (existing batch purity), ZEN-3862, ZEN-3862, 98.86%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[3-fluoro-4-(oxiran-2-yl)phenyl]methyl]pyridin-2-one (CAS 1952264-33-3) is a chemical compound with the molecular formula C19H17FN2O3 and a molecular weight of 340.3 g/mol. IUPAC name: 5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[3-fluoro-4-(oxiran-2-yl)phenyl]methyl]pyridin-2-one. InChIKey: VQHDSZCBMWYGEK-UHFFFAOYSA-N.
| Molecular formula | C19H17FN2O3 |
|---|---|
| Molecular weight | 340.3 g/mol |
| IUPAC name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-1-[[3-fluoro-4-(oxiran-2-yl)phenyl]methyl]pyridin-2-one |
| InChIKey | VQHDSZCBMWYGEK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CN(C(=O)C=C2)CC3=CC(=C(C=C3)C4CO4)F |
Computed by PubChem (NCBI)