CAS 667880-11-7 appears in our catalog under these names: ZINC00640089/ 99.27% (existing batch purity), ZINC00640089, ZINC00640089 98%, 2-(2-Oxobenzo[cd]indol-1(2H)-yl)-N-(2-(trifluoromethyl)phenyl)acetamide, 98%, 98%, ZINC00640089, 99.95%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 50 mg.
2-(2-oxobenzo[cd]indol-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide (CAS 667880-11-7) is a chemical compound with the molecular formula C20H13F3N2O2 and a molecular weight of 370.3 g/mol. IUPAC name: 2-(2-oxobenzo[cd]indol-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide. InChIKey: BJLGMVSRCCPPDE-UHFFFAOYSA-N.
| Molecular formula | C20H13F3N2O2 |
|---|---|
| Molecular weight | 370.3 g/mol |
| IUPAC name | 2-(2-oxobenzo[cd]indol-1-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
| InChIKey | BJLGMVSRCCPPDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(F)(F)F)NC(=O)CN2C3=CC=CC4=C3C(=CC=C4)C2=O |
Computed by PubChem (NCBI)