CAS 1010888-06-8 appears in our catalog under these names: ZINC12409120/ 98.69% (existing batch purity), ZINC12409120, ZINC12409120, 99.95%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg.
3,4-dihydro-1H-isoquinolin-2-yl-[3-(1H-indol-4-yl)-1,2,4-oxadiazol-5-yl]methanone (CAS 1010888-06-8) is a chemical compound with the molecular formula C20H16N4O2 and a molecular weight of 344.4 g/mol. IUPAC name: 3,4-dihydro-1H-isoquinolin-2-yl-[3-(1H-indol-4-yl)-1,2,4-oxadiazol-5-yl]methanone. InChIKey: BIUXGRRZAUBPEA-UHFFFAOYSA-N.
| Molecular formula | C20H16N4O2 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 3,4-dihydro-1H-isoquinolin-2-yl-[3-(1H-indol-4-yl)-1,2,4-oxadiazol-5-yl]methanone |
| InChIKey | BIUXGRRZAUBPEA-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C(=O)C3=NC(=NO3)C4=C5C=CNC5=CC=C4 |
Computed by PubChem (NCBI)