CAS 2230496-99-6 appears in our catalog under these names: ZL0590/ 99.95% (existing batch purity), ZL0590, ZL0590, 99.86%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
1-[4-[(2S)-2-(morpholin-4-ylmethyl)pyrrolidin-1-yl]sulfonylphenyl]-3-[4-(trifluoromethyl)phenyl]urea (CAS 2230496-99-6) is a chemical compound with the molecular formula C23H27F3N4O4S and a molecular weight of 512.5 g/mol. IUPAC name: 1-[4-[(2S)-2-(morpholin-4-ylmethyl)pyrrolidin-1-yl]sulfonylphenyl]-3-[4-(trifluoromethyl)phenyl]urea. InChIKey: ZPMULUKHFNMJPF-FQEVSTJZSA-N.
| Molecular formula | C23H27F3N4O4S |
|---|---|
| Molecular weight | 512.5 g/mol |
| IUPAC name | 1-[4-[(2S)-2-(morpholin-4-ylmethyl)pyrrolidin-1-yl]sulfonylphenyl]-3-[4-(trifluoromethyl)phenyl]urea |
| InChIKey | ZPMULUKHFNMJPF-FQEVSTJZSA-N |
| SMILES | C1C[C@H](N(C1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)NC3=CC=C(C=C3)C(F)(F)F)CN4CCOCC4 |
Computed by PubChem (NCBI)