CAS 1606974-33-7 appears in our catalog under these names: Zatolmilast, Zatolmilast/ 99.31% (existing batch purity), BPN14770, Zatolmilast 99%, 4-[[2-(3-Chlorophenyl)-6-(trifluoromethyl)-4-pyridinyl]methyl]benzeneacetic acid, 98%, 98%. Offered by: TRC, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[4-[[2-(3-chlorophenyl)-6-(trifluoromethyl)-4-pyridinyl]methyl]phenyl]acetic acid (CAS 1606974-33-7) is a chemical compound with the molecular formula C21H15ClF3NO2 and a molecular weight of 405.8 g/mol. IUPAC name: 2-[4-[[2-(3-chlorophenyl)-6-(trifluoromethyl)-4-pyridinyl]methyl]phenyl]acetic acid. InChIKey: LTSUMTMGJHPGFX-UHFFFAOYSA-N.
| Molecular formula | C21H15ClF3NO2 |
|---|---|
| Molecular weight | 405.8 g/mol |
| IUPAC name | 2-[4-[[2-(3-chlorophenyl)-6-(trifluoromethyl)-4-pyridinyl]methyl]phenyl]acetic acid |
| InChIKey | LTSUMTMGJHPGFX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NC(=CC(=C2)CC3=CC=C(C=C3)CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)