CAS 1713240-67-5 appears in our catalog under these names: CM–4620, Zegocractin/ 99.59% (existing batch purity), CM-4620, Zegocractin 99%, N-[5-(6-Chloro-2,2-difluoro-1,3-benzodioxol-5-yl)-2-pyrazinyl]-2-fluoro-6-methylbenzamide, 99%, 99%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-2-fluoro-6-methylbenzamide (CAS 1713240-67-5) is a chemical compound with the molecular formula C19H11ClF3N3O3 and a molecular weight of 421.8 g/mol. IUPAC name: N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-2-fluoro-6-methylbenzamide. InChIKey: QQMKTHUGOQDEIL-UHFFFAOYSA-N.
| Molecular formula | C19H11ClF3N3O3 |
|---|---|
| Molecular weight | 421.8 g/mol |
| IUPAC name | N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-2-fluoro-6-methylbenzamide |
| InChIKey | QQMKTHUGOQDEIL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)F)C(=O)NC2=NC=C(N=C2)C3=CC4=C(C=C3Cl)OC(O4)(F)F |
Computed by PubChem (NCBI)