CAS 2772600-18-5 appears in our catalog under these names: Zharp2–1, Zharp2-1/ 99.41% (existing batch purity), Zharp2-1, Zharp2-1, 99.59%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 200mg, 100 mg.
N-(6-dimethylphosphoryl-7-methoxyquinolin-4-yl)-1,3-benzothiazol-5-amine (CAS 2772600-18-5) is a chemical compound with the molecular formula C19H18N3O2PS and a molecular weight of 383.4 g/mol. IUPAC name: N-(6-dimethylphosphoryl-7-methoxyquinolin-4-yl)-1,3-benzothiazol-5-amine. InChIKey: SCBFIYRRWCWQAT-UHFFFAOYSA-N.
| Molecular formula | C19H18N3O2PS |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | N-(6-dimethylphosphoryl-7-methoxyquinolin-4-yl)-1,3-benzothiazol-5-amine |
| InChIKey | SCBFIYRRWCWQAT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=CC(=C2C=C1P(=O)(C)C)NC3=CC4=C(C=C3)SC=N4 |
Computed by PubChem (NCBI)