cas: 24308-84-7 — see every product listed under this CAS number, including other names
Zinc benzenesulfinate dihydrate, 95%, 95% (CAS 24308-84-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148RY-5g |
| cas | 24308-84-7 |
| size | 5g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 102.80 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 100g | 232.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Zinc benzenesulfinate (CAS 24308-84-7) is a chemical compound with the molecular formula C12H10O4S2Zn and a molecular weight of 347.7 g/mol. IUPAC name: zinc benzenesulfinate. InChIKey: UMGLWJIVIBWZCW-UHFFFAOYSA-L.
| Molecular formula | C12H10O4S2Zn |
|---|---|
| Molecular weight | 347.7 g/mol |
| IUPAC name | zinc benzenesulfinate |
| InChIKey | UMGLWJIVIBWZCW-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)S(=O)[O-].C1=CC=C(C=C1)S(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)