CAS 24308-84-7 appears in our catalog under these names: Zinc benzenesulfinate dihydrate, 98%, Zinc benzenesulfinate dihydrate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 1g, 5g, 100g.
Zinc benzenesulfinate (CAS 24308-84-7) is a chemical compound with the molecular formula C12H10O4S2Zn and a molecular weight of 347.7 g/mol. IUPAC name: zinc benzenesulfinate. InChIKey: UMGLWJIVIBWZCW-UHFFFAOYSA-L.
| Molecular formula | C12H10O4S2Zn |
|---|---|
| Molecular weight | 347.7 g/mol |
| IUPAC name | zinc benzenesulfinate |
| InChIKey | UMGLWJIVIBWZCW-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)S(=O)[O-].C1=CC=C(C=C1)S(=O)[O-].[Zn+2] |
Computed by PubChem (NCBI)