cas: 13598-37-3 — see every product listed under this CAS number, including other names
Zinc dihydrogen phosphate, 98%, 98% (CAS 13598-37-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114962-25g |
| cas | 13598-37-3 |
| size | 25g |
| availability | 16000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 93.20 Pln | |
| Chemat | 500g | 235.20 Pln | |
| Chemat | 1kg | 371.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Zinc diphosphate (CAS 13598-37-3) is a chemical compound with the molecular formula O8P2Zn-4 and a molecular weight of 255.3 g/mol. IUPAC name: zinc diphosphate. InChIKey: MFXMOUUKFMDYLM-UHFFFAOYSA-H.
| Molecular formula | O8P2Zn-4 |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | zinc diphosphate |
| InChIKey | MFXMOUUKFMDYLM-UHFFFAOYSA-H |
| SMILES | [O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[Zn+2] |
Computed by PubChem (NCBI)