cas: 13598-37-3 — see every product listed under this CAS number, including other names
Zinc dihydrogen phosphate, 98% (CAS 13598-37-3) is a chemical reagent available from Chemat. Available pack sizes: 1 kg, 100 g, 500 g, 25g, 500g. Offered by: MedChemExpress, Fluorochem.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W414898-1 kg |
| cas | 13598-37-3 |
| size | 1 kg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 kg | 528.67 Pln | |
| MedChemExpress | 100 g | 240.74 Pln | |
| MedChemExpress | 500 g | 375.42 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 500g | 247.85 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98% |
Zinc diphosphate (CAS 13598-37-3) is a chemical compound with the molecular formula O8P2Zn-4 and a molecular weight of 255.3 g/mol. IUPAC name: zinc diphosphate. InChIKey: MFXMOUUKFMDYLM-UHFFFAOYSA-H.
| Molecular formula | O8P2Zn-4 |
|---|---|
| Molecular weight | 255.3 g/mol |
| IUPAC name | zinc diphosphate |
| InChIKey | MFXMOUUKFMDYLM-UHFFFAOYSA-H |
| SMILES | [O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[Zn+2] |
Computed by PubChem (NCBI)