cas: 434-45-7 — see every product listed under this CAS number, including other names
alpha,alpha,alpha-Trifluoroacetophenone, 99% (CAS 434-45-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 148350050 |
| cas | 434-45-7 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 135.42 Pln | |
| Thermo Scientific (Acros) | 25g | 399.56 Pln | |
| Thermo Scientific (Acros) | 100g | 1113.61 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
2,2,2-trifluoro-1-phenylethanone (CAS 434-45-7) is a chemical compound with the molecular formula C8H5F3O and a molecular weight of 174.12 g/mol. IUPAC name: 2,2,2-trifluoro-1-phenylethanone. InChIKey: KZJRKRQSDZGHEC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O |
|---|---|
| Molecular weight | 174.12 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-phenylethanone |
| InChIKey | KZJRKRQSDZGHEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)