cas: 24802-07-1 — see every product listed under this CAS number, including other names
alpha,alpha-Dimethyl-3-isopropenylbenzenemethanol, 95%, 95% (CAS 24802-07-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FNJ3-100mg |
| cas | 24802-07-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 602.00 Pln | |
| Chemat | 250mg | 1144.40 Pln | |
| Chemat | 1g | 3098.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3-prop-1-en-2-ylphenyl)propan-2-ol (CAS 24802-07-1) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 2-(3-prop-1-en-2-ylphenyl)propan-2-ol. InChIKey: UENHVTKPLPMSGQ-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 2-(3-prop-1-en-2-ylphenyl)propan-2-ol |
| InChIKey | UENHVTKPLPMSGQ-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC(=CC=C1)C(C)(C)O |
Computed by PubChem (NCBI)