CAS 30314-44-4 appears in our catalog under these names: 4',2,2–Trimethylpropiophenone, 4',2,2-Trimethylpropiophenone, 4',2,2-Trimethylpropiophenone, 95%, 2,2-Dimethyl-1-(4-methylphenyl)propan-1-one, 95%. Offered by: GLPBio, Biosynth, Ambeed, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg, 5g, 2,5g.
2,2-dimethyl-1-(4-methylphenyl)propan-1-one (CAS 30314-44-4) is a chemical compound with the molecular formula C12H16O and a molecular weight of 176.25 g/mol. IUPAC name: 2,2-dimethyl-1-(4-methylphenyl)propan-1-one. InChIKey: ZYWGAHRBGCEFAO-UHFFFAOYSA-N.
| Molecular formula | C12H16O |
|---|---|
| Molecular weight | 176.25 g/mol |
| IUPAC name | 2,2-dimethyl-1-(4-methylphenyl)propan-1-one |
| InChIKey | ZYWGAHRBGCEFAO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C(C)(C)C |
Computed by PubChem (NCBI)