CAS 86194-41-4 appears in our catalog under these names: alpha-HCH D6, alpha-HCH D6 100 µg/mL in Cyclohexane, D6-alpha-HCH, Concentration: 100 µg/ml Solvent: Cyclohexane. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 1ml, 1x1ml.
1,2,3,4,5,6-hexachloro-1,2,3,4,5,6-hexadeuteriocyclohexane (CAS 86194-41-4) is a chemical compound with the molecular formula C6H6Cl6 and a molecular weight of 296.9 g/mol. IUPAC name: 1,2,3,4,5,6-hexachloro-1,2,3,4,5,6-hexadeuteriocyclohexane. InChIKey: JLYXXMFPNIAWKQ-MZWXYZOWSA-N.
| Molecular formula | C6H6Cl6 |
|---|---|
| Molecular weight | 296.9 g/mol |
| IUPAC name | 1,2,3,4,5,6-hexachloro-1,2,3,4,5,6-hexadeuteriocyclohexane |
| InChIKey | JLYXXMFPNIAWKQ-MZWXYZOWSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])Cl)([2H])Cl)([2H])Cl)([2H])Cl)([2H])Cl)Cl |
Computed by PubChem (NCBI)