cas: 2195385-11-4 — see every product listed under this CAS number, including other names
benzyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate, 97% (CAS 2195385-11-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F867009-100MG |
| cas | 2195385-11-4 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 997.58 Pln | |
| Fluorochem | 250mg | 1544.27 Pln | |
| Fluorochem | 500mg | 2507.47 Pln | |
| Fluorochem | 1g | 3673.72 Pln | |
| Fluorochem | 5g | 10650.43 Pln | |
| Fluorochem | 10g | 17700.04 Pln | |
| Chemat | 100mg | 573.20 Pln | |
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 500mg | 1418.00 Pln | |
| Chemat | 1g | 2090.00 Pln | |
| Chemat | 5g | 6150.80 Pln | |
| Chemat | 10g | 10206.80 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Benzyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate (CAS 2195385-11-4) is a chemical compound with the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. IUPAC name: benzyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: RSMKUMJCVWVRAZ-YNEHKIRRSA-N.
| Molecular formula | C14H17NO3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | benzyl (1R,4S,6R)-6-hydroxy-2-azabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | RSMKUMJCVWVRAZ-YNEHKIRRSA-N |
| SMILES | C1[C@H]2C[C@H]([C@@H]1N(C2)C(=O)OCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)