cas: 315717-76-1 — see every product listed under this CAS number, including other names
benzyl 3-(aminomethyl)piperidine-1-carboxylate, 95%, 95% (CAS 315717-76-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I6ZH-1g |
| cas | 315717-76-1 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1125.20 Pln | |
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 592.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-(aminomethyl)piperidine-1-carboxylate (CAS 315717-76-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl 3-(aminomethyl)piperidine-1-carboxylate. InChIKey: PAIJQGYSIGOWOF-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl 3-(aminomethyl)piperidine-1-carboxylate |
| InChIKey | PAIJQGYSIGOWOF-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)OCC2=CC=CC=C2)CN |
Computed by PubChem (NCBI)