CAS 1217977-11-1 is the registry number for (R)-1-Cbz-3-aminomethyl-piperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Benzyl (3R)-3-(aminomethyl)piperidine-1-carboxylate (CAS 1217977-11-1) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl (3R)-3-(aminomethyl)piperidine-1-carboxylate. InChIKey: PAIJQGYSIGOWOF-CYBMUJFWSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl (3R)-3-(aminomethyl)piperidine-1-carboxylate |
| InChIKey | PAIJQGYSIGOWOF-CYBMUJFWSA-N |
| SMILES | C1C[C@@H](CN(C1)C(=O)OCC2=CC=CC=C2)CN |
Computed by PubChem (NCBI)