cas: 939759-26-9 — see every product listed under this CAS number, including other names
benzyl 3-iodoazetidine-1-carboxylate, 97%, 97% (CAS 939759-26-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116WRI-100mg |
| cas | 939759-26-9 |
| size | 100mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 304.40 Pln | |
| Chemat | 10g | 438.80 Pln | |
| Chemat | 25g | 683.60 Pln | |
| Chemat | 50g | 1163.60 Pln | |
| Chemat | 100g | 1782.80 Pln | |
| Chemat | 250g | 3923.60 Pln | |
| Chemat | 500g | 7507.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-iodoazetidine-1-carboxylate (CAS 939759-26-9) is a chemical compound with the molecular formula C11H12INO2 and a molecular weight of 317.12 g/mol. IUPAC name: benzyl 3-iodoazetidine-1-carboxylate. InChIKey: SNXKRIUJMHHPOB-UHFFFAOYSA-N.
| Molecular formula | C11H12INO2 |
|---|---|
| Molecular weight | 317.12 g/mol |
| IUPAC name | benzyl 3-iodoazetidine-1-carboxylate |
| InChIKey | SNXKRIUJMHHPOB-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2=CC=CC=C2)I |
Computed by PubChem (NCBI)