CAS 1381947-63-2 is the registry number for (3R,4S)-rel-4-(2-Iodophenyl)pyrrolidine-3-carboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-4-(2-iodophenyl)pyrrolidine-3-carboxylic acid (CAS 1381947-63-2) is a chemical compound with the molecular formula C11H12INO2 and a molecular weight of 317.12 g/mol. IUPAC name: (3R,4S)-4-(2-iodophenyl)pyrrolidine-3-carboxylic acid. InChIKey: RVUARRDJOQHAHU-BDAKNGLRSA-N.
| Molecular formula | C11H12INO2 |
|---|---|
| Molecular weight | 317.12 g/mol |
| IUPAC name | (3R,4S)-4-(2-iodophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | RVUARRDJOQHAHU-BDAKNGLRSA-N |
| SMILES | C1[C@@H]([C@H](CN1)C(=O)O)C2=CC=CC=C2I |
Computed by PubChem (NCBI)