cas: 883546-93-8 — see every product listed under this CAS number, including other names
benzyl 4-(3-aminoazetidin-1-yl)piperidine-1-carboxylate, 97%, 97% (CAS 883546-93-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IF30-250mg |
| cas | 883546-93-8 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 500mg | 952.40 Pln | |
| Chemat | 1g | 1427.60 Pln | |
| Chemat | 5g | 3266.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 4-(3-aminoazetidin-1-yl)piperidine-1-carboxylate (CAS 883546-93-8) is a chemical compound with the molecular formula C16H23N3O2 and a molecular weight of 289.37 g/mol. IUPAC name: benzyl 4-(3-aminoazetidin-1-yl)piperidine-1-carboxylate. InChIKey: IWHDHWNOKIWMGK-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O2 |
|---|---|
| Molecular weight | 289.37 g/mol |
| IUPAC name | benzyl 4-(3-aminoazetidin-1-yl)piperidine-1-carboxylate |
| InChIKey | IWHDHWNOKIWMGK-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N2CC(C2)N)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)