cas: 883546-93-8 — see every product listed under this CAS number, including other names
Benzyl 4-(3-aminoazetidin-1-yl)piperidine-1-carboxylate, 97% (CAS 883546-93-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A944626-10g |
| cas | 883546-93-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8936.62 Pln | |
| AmBeed | 5g | 5824.84 Pln | |
| AmBeed | 25g | 17581.90 Pln | |
| Fluorochem | 250mg | 857.01 Pln | |
| Fluorochem | 500mg | 1549.47 Pln | |
| Fluorochem | 1g | 2340.86 Pln | |
| Fluorochem | 5g | 5381.46 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl 4-(3-aminoazetidin-1-yl)piperidine-1-carboxylate (CAS 883546-93-8) is a chemical compound with the molecular formula C16H23N3O2 and a molecular weight of 289.37 g/mol. IUPAC name: benzyl 4-(3-aminoazetidin-1-yl)piperidine-1-carboxylate. InChIKey: IWHDHWNOKIWMGK-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O2 |
|---|---|
| Molecular weight | 289.37 g/mol |
| IUPAC name | benzyl 4-(3-aminoazetidin-1-yl)piperidine-1-carboxylate |
| InChIKey | IWHDHWNOKIWMGK-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N2CC(C2)N)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)