cas: 218943-31-8 — see every product listed under this CAS number, including other names
boc-b-homo-ser(bzl)-oh (CAS 218943-31-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045415-100MG |
| cas | 218943-31-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 107.27 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 424.87 Pln |
| delivery time | 3-4 weeks |
|---|
(3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxybutanoic acid (CAS 218943-31-8) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxybutanoic acid. InChIKey: BNSXKDBZQDOLAL-CYBMUJFWSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | (3R)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylmethoxybutanoic acid |
| InChIKey | BNSXKDBZQDOLAL-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)O)COCC1=CC=CC=C1 |
Computed by PubChem (NCBI)