CAS 72155-48-7 appears in our catalog under these names: Boc-ahppa-oh, 98%, (3S,4S)-4-((tert-Butoxycarbonyl)amino)-3-hydroxy-5-phenylpentanoic acid, 97%, Boc–(3S,4S)–4–amino–3–hydroxy–5–phenylpentanoic Acid, Boc-(3S,4S)-AHPPA-OH, Boc-ahppa-oh, 99%, 99%. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 25mg.
(3S,4S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid (CAS 72155-48-7) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: (3S,4S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid. InChIKey: SOSXJQKIIYOJPF-STQMWFEESA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | (3S,4S)-3-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-phenylpentanoic acid |
| InChIKey | SOSXJQKIIYOJPF-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[C@H](CC(=O)O)O |
Computed by PubChem (NCBI)