CAS 2622-30-2 appears in our catalog under these names: 1-Propanone,1-[10-[3-[4-(2-hydroxyethyl)-1-piperazinyl]propyl]-10H-phenothiazin-2-yl]-, 98.15% ,, 98.15% ,, Carphenazine, Carfenazine, carfenazine/ 98.15% (existing batch purity), Carphenazine, 99.16%. Offered by: Chemat, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 1 mg.
1-[10-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl]phenothiazin-2-yl]propan-1-one (CAS 2622-30-2) is a chemical compound with the molecular formula C24H31N3O2S and a molecular weight of 425.6 g/mol. IUPAC name: 1-[10-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl]phenothiazin-2-yl]propan-1-one. InChIKey: XZSMZRXAEFNJCU-UHFFFAOYSA-N.
| Molecular formula | C24H31N3O2S |
|---|---|
| Molecular weight | 425.6 g/mol |
| IUPAC name | 1-[10-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl]phenothiazin-2-yl]propan-1-one |
| InChIKey | XZSMZRXAEFNJCU-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN4CCN(CC4)CCO |
Computed by PubChem (NCBI)